C16H22N6O4S2 — CID 144641051
2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 144641051) has the molecular formula C16H22N6O4S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 144641051 |
| Molecular Formula | C16H22N6O4S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CNc1nnc(CCCCc2nnc(NC(=O)CC3OC(C)(C)OC3=O)s2)s1 |
| InChI | InChI=1S/C16H22N6O4S2/c1-16(2)25-9(13(24)26-16)8-10(23)18-15-22-20-12(28-15)7-5-4-6-11-19-21-14(17-3)27-11/h9H,4-8H2,1-3H3,(H,17,21)(H,18,22,23) |
| InChIKey | SPGSCYWKIBQLKZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|