C14H23N3OS — CID 52896832
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide (PubChem CID 52896832) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 52896832 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyclohexylacetamide |
| SMILES | CCCCc1nnc(NC(=O)CC2CCCCC2)s1 |
| InChI | InChI=1S/C14H23N3OS/c1-2-3-9-13-16-17-14(19-13)15-12(18)10-11-7-5-4-6-8-11/h11H,2-10H2,1H3,(H,15,17,18) |
| InChIKey | DPAJSMLUKFLROS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |