C13H22N4OS — CID 119265861
N-(5-pentyl-1,3,4-thiadiazol-2-yl)piperidine-2-carboxamide (PubChem CID 119265861) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)piperidine-2-carboxamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119265861 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)piperidine-2-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)C2CCCCN2)s1 |
| InChI | InChI=1S/C13H22N4OS/c1-2-3-4-8-11-16-17-13(19-11)15-12(18)10-7-5-6-9-14-10/h10,14H,2-9H2,1H3,(H,15,17,18) |
| InChIKey | CHJPOXBHMQHKPL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|