C20H23N7OS2 — CID 139565216
N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 139565216) has the molecular formula C20H23N7OS2 and a molecular weight of 441.59 g/mol. Its IUPAC name is N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 139565216 |
| Molecular Formula | C20H23N7OS2 |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | CNc1nnc(CCCCc2nnc(NC(=O)Cc3c(C)[nH]c4ccccc34)s2)s1 |
| InChI | InChI=1S/C20H23N7OS2/c1-12-14(13-7-3-4-8-15(13)22-12)11-16(28)23-20-27-25-18(30-20)10-6-5-9-17-24-26-19(21-2)29-17/h3-4,7-8,22H,5-6,9-11H2,1-2H3,(H,21,26)(H,23,27,28) |
| InChIKey | CLTFFOAHBHOGOL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|