C20H17N3OS — CID 86979349
2-(2-methyl-1H-indol-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 86979349) has the molecular formula C20H17N3OS and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 86979349 |
| Molecular Formula | C20H17N3OS |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-N-(5-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C20H17N3OS/c1-13-16(15-9-5-6-10-17(15)22-13)11-19(24)23-20-21-12-18(25-20)14-7-3-2-4-8-14/h2-10,12,22H,11H2,1H3,(H,21,23,24) |
| InChIKey | WXVRFASDBQQTMK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|