C16H20N2O3 — CID 43630780
2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid (PubChem CID 43630780) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | 2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 43630780 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)Cc1c(C)[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O3/c1-3-6-14(16(20)21)18-15(19)9-12-10(2)17-13-8-5-4-7-11(12)13/h4-5,7-8,14,17H,3,6,9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | UTFPLIWGWBJWGA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|