C17H22N2O3 — CID 119192323
2-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid (PubChem CID 119192323) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid.
| Compound Name | 2-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119192323 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]pentanoic acid |
| SMILES | CCCC(C)(NC(=O)Cc1c(C)[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H22N2O3/c1-4-9-17(3,16(21)22)19-15(20)10-13-11(2)18-14-8-6-5-7-12(13)14/h5-8,18H,4,9-10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | LARSOSKIVBTKMS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|