C16H19N3O5 — CID 119192243
2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-methylpentanoic acid (PubChem CID 119192243) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-methylpentanoic acid.
| Compound Name | 2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 119192243 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)Cn1c(=O)[nH]c2ccccc2c1=O)C(=O)O |
| InChI | InChI=1S/C16H19N3O5/c1-3-8-16(2,14(22)23)18-12(20)9-19-13(21)10-6-4-5-7-11(10)17-15(19)24/h4-7H,3,8-9H2,1-2H3,(H,17,24)(H,18,20)(H,22,23) |
| InChIKey | GBCRRLXJQLAAQK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |