C18H14N3O5- — CID 7692705
(2R)-2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-phenylacetate (PubChem CID 7692705) has the molecular formula C18H14N3O5- and a molecular weight of 352.33 g/mol. Its IUPAC name is (2R)-2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-phenylacetate.
| Compound Name | (2R)-2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 7692705 |
| Molecular Formula | C18H14N3O5- |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2R)-2-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]-2-phenylacetate |
| SMILES | O=C(Cn1c(=O)[nH]c2ccccc2c1=O)N[C@@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C18H15N3O5/c22-14(20-15(17(24)25)11-6-2-1-3-7-11)10-21-16(23)12-8-4-5-9-13(12)19-18(21)26/h1-9,15H,10H2,(H,19,26)(H,20,22)(H,24,25)/p-1/t15-/m1/s1 |
| InChIKey | MIELMRRMRQVLQY-OAHLLOKOSA-M |
| XLogP | -0.70 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |