C16H21N5O3 — CID 119447887
2-(2,4-dioxo-1H-quinazolin-3-yl)-N-(2-piperazin-1-ylethyl)acetamide (PubChem CID 119447887) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-quinazolin-3-yl)-N-(2-piperazin-1-ylethyl)acetamide.
| Compound Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-N-(2-piperazin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 119447887 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-N-(2-piperazin-1-ylethyl)acetamide |
| SMILES | O=C(Cn1c(=O)[nH]c2ccccc2c1=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C16H21N5O3/c22-14(18-7-10-20-8-5-17-6-9-20)11-21-15(23)12-3-1-2-4-13(12)19-16(21)24/h1-4,17H,5-11H2,(H,18,22)(H,19,24) |
| InChIKey | DRCOLZYTGGZTRM-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |