C14H15N3O5 — CID 119221288
3-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]butanoic acid (PubChem CID 119221288) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 3-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]butanoic acid.
| Compound Name | 3-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119221288 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-[[2-(2,4-dioxo-1H-quinazolin-3-yl)acetyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)Cn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C14H15N3O5/c1-8(6-12(19)20)15-11(18)7-17-13(21)9-4-2-3-5-10(9)16-14(17)22/h2-5,8H,6-7H2,1H3,(H,15,18)(H,16,22)(H,19,20) |
| InChIKey | ILLJIUGTYNPDTK-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |