C19H18N6O4S — CID 175683951
2-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]acetamide (PubChem CID 175683951) has the molecular formula C19H18N6O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]acetamide.
| Compound Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 175683951 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-N-[2-oxo-2-[2-(phenylcarbamothioyl)hydrazinyl]ethyl]acetamide |
| SMILES | O=C(Cn1c(=O)[nH]c2ccccc2c1=O)NCC(=O)NNC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C19H18N6O4S/c26-15(23-24-18(30)21-12-6-2-1-3-7-12)10-20-16(27)11-25-17(28)13-8-4-5-9-14(13)22-19(25)29/h1-9H,10-11H2,(H,20,27)(H,22,29)(H,23,26)(H2,21,24,30) |
| InChIKey | DIHVQLWMMMSSRQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|