C18H18N4O5S — CID 55600769
N-[4-(dimethylsulfamoyl)phenyl]-2-(2,4-dioxo-1H-quinazolin-3-yl)acetamide (PubChem CID 55600769) has the molecular formula C18H18N4O5S and a molecular weight of 402.43 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-2-(2,4-dioxo-1H-quinazolin-3-yl)acetamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-2-(2,4-dioxo-1H-quinazolin-3-yl)acetamide |
|---|---|
| PubChem CID | 55600769 |
| Molecular Formula | C18H18N4O5S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-2-(2,4-dioxo-1H-quinazolin-3-yl)acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)Cn2c(=O)[nH]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C18H18N4O5S/c1-21(2)28(26,27)13-9-7-12(8-10-13)19-16(23)11-22-17(24)14-5-3-4-6-15(14)20-18(22)25/h3-10H,11H2,1-2H3,(H,19,23)(H,20,25) |
| InChIKey | JHDJLYAIHOSOBI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |