C20H20N2O3S2 — CID 9457949
N-[4-(dimethylsulfamoyl)phenyl]-2-naphthalen-1-ylsulfanylacetamide (PubChem CID 9457949) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[4-(dimethylsulfamoyl)phenyl]-2-naphthalen-1-ylsulfanylacetamide.
| Compound Name | N-[4-(dimethylsulfamoyl)phenyl]-2-naphthalen-1-ylsulfanylacetamide |
|---|---|
| PubChem CID | 9457949 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[4-(dimethylsulfamoyl)phenyl]-2-naphthalen-1-ylsulfanylacetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(NC(=O)CSc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C20H20N2O3S2/c1-22(2)27(24,25)17-12-10-16(11-13-17)21-20(23)14-26-19-9-5-7-15-6-3-4-8-18(15)19/h3-13H,14H2,1-2H3,(H,21,23) |
| InChIKey | ODMTXEOZHUKSPR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |