C18H24N3O3S+ — CID 8897553
[2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium (PubChem CID 8897553) has the molecular formula C18H24N3O3S+ and a molecular weight of 362.48 g/mol. Its IUPAC name is [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium.
| Compound Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 8897553 |
| Molecular Formula | C18H24N3O3S+ |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | [2-[4-(dimethylsulfamoyl)anilino]-2-oxoethyl]-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]CC(=O)Nc1ccc(S(=O)(=O)N(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-14(15-7-5-4-6-8-15)19-13-18(22)20-16-9-11-17(12-10-16)25(23,24)21(2)3/h4-12,14,19H,13H2,1-3H3,(H,20,22)/p+1/t14-/m0/s1 |
| InChIKey | RPAQZNTXLIGZDP-AWEZNQCLSA-O |
| XLogP | 1.20 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |