C17H16N4O3 — CID 172640271
1-[(2,4-dioxo-1H-quinazolin-3-yl)methyl]-3-(4-methylphenyl)urea (PubChem CID 172640271) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-[(2,4-dioxo-1H-quinazolin-3-yl)methyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(2,4-dioxo-1H-quinazolin-3-yl)methyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 172640271 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[(2,4-dioxo-1H-quinazolin-3-yl)methyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCn2c(=O)[nH]c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C17H16N4O3/c1-11-6-8-12(9-7-11)19-16(23)18-10-21-15(22)13-4-2-3-5-14(13)20-17(21)24/h2-9H,10H2,1H3,(H,20,24)(H2,18,19,23) |
| InChIKey | PERRAFORRCZORL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |