C18H16ClN3O3 — CID 4302111
N-(4-chlorophenyl)-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide (PubChem CID 4302111) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide.
| Compound Name | N-(4-chlorophenyl)-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 4302111 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N-(4-chlorophenyl)-4-(2,4-dioxo-1H-quinazolin-3-yl)butanamide |
| SMILES | O=C(CCCn1c(=O)[nH]c2ccccc2c1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3O3/c19-12-7-9-13(10-8-12)20-16(23)6-3-11-22-17(24)14-4-1-2-5-15(14)21-18(22)25/h1-2,4-5,7-10H,3,6,11H2,(H,20,23)(H,21,25) |
| InChIKey | VKTVCUUTFHJSDD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |