C17H14ClN3O3 — CID 4973826
N-(3-chlorophenyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)propanamide (PubChem CID 4973826) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)propanamide.
| Compound Name | N-(3-chlorophenyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 4973826 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-(3-chlorophenyl)-3-(2,4-dioxo-1H-quinazolin-3-yl)propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c2ccccc2c1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H14ClN3O3/c18-11-4-3-5-12(10-11)19-15(22)8-9-21-16(23)13-6-1-2-7-14(13)20-17(21)24/h1-7,10H,8-9H2,(H,19,22)(H,20,24) |
| InChIKey | UKOOJZSRVLQPED-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |