C18H14F3N3O3 — CID 4903112
3-(2,4-dioxo-1H-quinazolin-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 4903112) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 4903112 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCn1c(=O)[nH]c2ccccc2c1=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F3N3O3/c19-18(20,21)11-4-3-5-12(10-11)22-15(25)8-9-24-16(26)13-6-1-2-7-14(13)23-17(24)27/h1-7,10H,8-9H2,(H,22,25)(H,23,27) |
| InChIKey | GEDAVEOOROXGFI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |