C21H17ClN4O2S2 — CID 46693324
N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide (PubChem CID 46693324) has the molecular formula C21H17ClN4O2S2 and a molecular weight of 456.98 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
|---|---|
| PubChem CID | 46693324 |
| Molecular Formula | C21H17ClN4O2S2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)propanamide |
| SMILES | O=C(CCn1c(=S)[nH]c2ccccc2c1=O)Nc1ncc(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C21H17ClN4O2S2/c22-14-5-3-4-13(10-14)11-15-12-23-20(30-15)25-18(27)8-9-26-19(28)16-6-1-2-7-17(16)24-21(26)29/h1-7,10,12H,8-9,11H2,(H,24,29)(H,23,25,27) |
| InChIKey | ZUVXVYKRGQSLSJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|