C21H21N3O5 — CID 4904247
N-(1,3-benzodioxol-5-yl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide (PubChem CID 4904247) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide |
|---|---|
| PubChem CID | 4904247 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide |
| SMILES | O=C(CCCCCn1c(=O)[nH]c2ccccc2c1=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21N3O5/c25-19(22-14-9-10-17-18(12-14)29-13-28-17)8-2-1-5-11-24-20(26)15-6-3-4-7-16(15)23-21(24)27/h3-4,6-7,9-10,12H,1-2,5,8,11,13H2,(H,22,25)(H,23,27) |
| InChIKey | AHQAMIBKTHDICQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|