C22H24ClN3O5 — CID 4905587
N-(5-chloro-2,4-dimethoxyphenyl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide (PubChem CID 4905587) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide |
|---|---|
| PubChem CID | 4905587 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-6-(2,4-dioxo-1H-quinazolin-3-yl)hexanamide |
| SMILES | COc1cc(OC)c(NC(=O)CCCCCn2c(=O)[nH]c3ccccc3c2=O)cc1Cl |
| InChI | InChI=1S/C22H24ClN3O5/c1-30-18-13-19(31-2)17(12-15(18)23)24-20(27)10-4-3-7-11-26-21(28)14-8-5-6-9-16(14)25-22(26)29/h5-6,8-9,12-13H,3-4,7,10-11H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | YPSLXKWUBVAICM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|