About 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide
5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide (PubChem CID 119103654) has the molecular formula C16H21N3O3
and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide.
Molecular Properties
| Compound Name | 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide |
| PubChem CID | 119103654 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide |
| SMILES | CCCNC(=O)CCCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C16H21N3O3/c1-2-10-17-14(20)9-5-6-11-19-15(21)12-7-3-4-8-13(12)18-16(19)22/h3-4,7-8H,2,5-6,9-11H2,1H3,(H,17,20)(H,18,22) |
| InChIKey | RPSNHIIJMYUQAN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide?
The IUPAC name of 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide (CID 119103654) is 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide.
What is the SMILES notation for 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide?
The canonical SMILES for 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide is CCCNC(=O)CCCCn1c(=O)[nH]c2ccccc2c1=O.
What is the InChIKey of 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide?
The InChIKey is RPSNHIIJMYUQAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3/c1-2-10-17-14(20)9-5-6-11-19-15(21)12-7-3-4-8-13(12)18-16(19)22/h3-4,7-8H,2,5-6,9-11H2,1H3,(H,17,20)(H,18,22).
What are the key properties of 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide?
5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide has a molecular weight of 303.36 g/mol, XLogP of 1.39, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dioxo-1H-quinazolin-3-yl)-N-propylpentanamide is sourced from PubChem (CID 119103654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).