C19H25N3O5 — CID 4834295
2-[6-(2,4-dioxo-1H-quinazolin-3-yl)hexanoylamino]-3-methylbutanoic acid (PubChem CID 4834295) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 2-[6-(2,4-dioxo-1H-quinazolin-3-yl)hexanoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[6-(2,4-dioxo-1H-quinazolin-3-yl)hexanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 4834295 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 2-[6-(2,4-dioxo-1H-quinazolin-3-yl)hexanoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)CCCCCn1c(=O)[nH]c2ccccc2c1=O)C(=O)O |
| InChI | InChI=1S/C19H25N3O5/c1-12(2)16(18(25)26)21-15(23)10-4-3-7-11-22-17(24)13-8-5-6-9-14(13)20-19(22)27/h5-6,8-9,12,16H,3-4,7,10-11H2,1-2H3,(H,20,27)(H,21,23)(H,25,26) |
| InChIKey | OWDWDFUDMKDEDG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 121.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|