C15H20N2O4 — CID 67872693
acetic acid;3-pentyl-1H-quinazoline-2,4-dione (PubChem CID 67872693) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is acetic acid;3-pentyl-1H-quinazoline-2,4-dione.
| Compound Name | acetic acid;3-pentyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 67872693 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | acetic acid;3-pentyl-1H-quinazoline-2,4-dione |
| SMILES | CC(=O)O.CCCCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C13H16N2O2.C2H4O2/c1-2-3-6-9-15-12(16)10-7-4-5-8-11(10)14-13(15)17;1-2(3)4/h4-5,7-8H,2-3,6,9H2,1H3,(H,14,17);1H3,(H,3,4) |
| InChIKey | JIZDZMWTXOZKJY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|