C16H20N2O4 — CID 59779886
2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl 2,2-dimethylbutanoate (PubChem CID 59779886) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59779886 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCn1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C16H20N2O4/c1-4-16(2,3)14(20)22-10-9-18-13(19)11-7-5-6-8-12(11)17-15(18)21/h5-8H,4,9-10H2,1-3H3,(H,17,21) |
| InChIKey | ITHZFLNZCPLOCB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |