C19H17ClN2O6S — CID 56528115
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-chloro-3-methylsulfonylbenzoate (PubChem CID 56528115) has the molecular formula C19H17ClN2O6S and a molecular weight of 436.87 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-chloro-3-methylsulfonylbenzoate.
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-chloro-3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 56528115 |
| Molecular Formula | C19H17ClN2O6S |
| Molecular Weight | 436.87 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-chloro-3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cc(C(=O)OCCCn2c(=O)[nH]c3ccccc3c2=O)ccc1Cl |
| InChI | InChI=1S/C19H17ClN2O6S/c1-29(26,27)16-11-12(7-8-14(16)20)18(24)28-10-4-9-22-17(23)13-5-2-3-6-15(13)21-19(22)25/h2-3,5-8,11H,4,9-10H2,1H3,(H,21,25) |
| InChIKey | IQUCDAZTMNADRJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.87 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|