C23H21N3O6 — CID 56528176
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 56528176) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 56528176 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCCCn1c(=O)[nH]c2ccccc2c1=O)c1ccc(CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C23H21N3O6/c27-19-10-11-20(28)26(19)14-15-6-8-16(9-7-15)22(30)32-13-3-12-25-21(29)17-4-1-2-5-18(17)24-23(25)31/h1-2,4-9H,3,10-14H2,(H,24,31) |
| InChIKey | AUSWIFIYQYNMHG-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|