C21H21N3O6S — CID 56528110
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 56528110) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 56528110 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | O=C(OCCCn1c(=O)[nH]c2ccccc2c1=O)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C21H21N3O6S/c25-19-17-8-1-2-9-18(17)22-21(27)23(19)10-4-12-30-20(26)15-6-3-7-16(14-15)24-11-5-13-31(24,28)29/h1-3,6-9,14H,4-5,10-13H2,(H,22,27) |
| InChIKey | VNLMJLQMPXOQJC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|