C17H16BrNO4S — CID 55508510
(2-bromophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 55508510) has the molecular formula C17H16BrNO4S and a molecular weight of 410.29 g/mol. Its IUPAC name is (2-bromophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
| Compound Name | (2-bromophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 55508510 |
| Molecular Formula | C17H16BrNO4S |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | (2-bromophenyl)methyl 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | O=C(OCc1ccccc1Br)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H16BrNO4S/c18-16-8-2-1-5-14(16)12-23-17(20)13-6-3-7-15(11-13)19-9-4-10-24(19,21)22/h1-3,5-8,11H,4,9-10,12H2 |
| InChIKey | XUUDPWRUXOTVAI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |