C15H20N2O6S — CID 55508802
[2-(2-methoxyethylamino)-2-oxoethyl] 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 55508802) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 55508802 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | COCCNC(=O)COC(=O)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C15H20N2O6S/c1-22-8-6-16-14(18)11-23-15(19)12-4-2-5-13(10-12)17-7-3-9-24(17,20)21/h2,4-5,10H,3,6-9,11H2,1H3,(H,16,18) |
| InChIKey | RQYRRDSJAUFSFU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|