C14H20N2O4 — CID 2518580
[2-(2-methoxyethylamino)-2-oxoethyl] 3-(dimethylamino)benzoate (PubChem CID 2518580) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 3-(dimethylamino)benzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 2518580 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 3-(dimethylamino)benzoate |
| SMILES | COCCNC(=O)COC(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-16(2)12-6-4-5-11(9-12)14(18)20-10-13(17)15-7-8-19-3/h4-6,9H,7-8,10H2,1-3H3,(H,15,17) |
| InChIKey | KUYZZXGXOIHORI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|