C21H26N2O6 — CID 2352182
2-[(3,4,5-trimethoxybenzoyl)amino]ethyl 3-(dimethylamino)benzoate (PubChem CID 2352182) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[(3,4,5-trimethoxybenzoyl)amino]ethyl 3-(dimethylamino)benzoate.
| Compound Name | 2-[(3,4,5-trimethoxybenzoyl)amino]ethyl 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 2352182 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[(3,4,5-trimethoxybenzoyl)amino]ethyl 3-(dimethylamino)benzoate |
| SMILES | COc1cc(C(=O)NCCOC(=O)c2cccc(N(C)C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N2O6/c1-23(2)16-8-6-7-14(11-16)21(25)29-10-9-22-20(24)15-12-17(26-3)19(28-5)18(13-15)27-4/h6-8,11-13H,9-10H2,1-5H3,(H,22,24) |
| InChIKey | SPOBMYWAHCZDIK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|