C21H28N2O4 — CID 8909756
N-[2-(N-ethyl-3-methylanilino)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 8909756) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[2-(N-ethyl-3-methylanilino)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(N-ethyl-3-methylanilino)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 8909756 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[2-(N-ethyl-3-methylanilino)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CCNC(=O)c1cc(OC)c(OC)c(OC)c1)c1cccc(C)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-6-23(17-9-7-8-15(2)12-17)11-10-22-21(24)16-13-18(25-3)20(27-5)19(14-16)26-4/h7-9,12-14H,6,10-11H2,1-5H3,(H,22,24) |
| InChIKey | ZMGPTPBMEKYODC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |