C18H21ClN2O6 — CID 2830245
2-(pyridin-1-ium-3-carbonylamino)ethyl 3,4,5-trimethoxybenzoate chloride (PubChem CID 2830245) has the molecular formula C18H21ClN2O6 and a molecular weight of 396.83 g/mol. Its IUPAC name is 2-(pyridin-1-ium-3-carbonylamino)ethyl 3,4,5-trimethoxybenzoate chloride.
| Compound Name | 2-(pyridin-1-ium-3-carbonylamino)ethyl 3,4,5-trimethoxybenzoate chloride |
|---|---|
| PubChem CID | 2830245 |
| Molecular Formula | C18H21ClN2O6 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 2-(pyridin-1-ium-3-carbonylamino)ethyl 3,4,5-trimethoxybenzoate chloride |
| SMILES | COc1cc(C(=O)OCCNC(=O)c2ccc[nH+]c2)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C18H20N2O6.ClH/c1-23-14-9-13(10-15(24-2)16(14)25-3)18(22)26-8-7-20-17(21)12-5-4-6-19-11-12;/h4-6,9-11H,7-8H2,1-3H3,(H,20,21);1H |
| InChIKey | YLFCEULCPUINIG-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|