C19H23N3O5 — CID 108926572
N-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]pyridine-3-carboxamide (PubChem CID 108926572) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108926572 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[3-[(3,4,5-trimethoxybenzoyl)amino]propyl]pyridine-3-carboxamide |
| SMILES | COc1cc(C(=O)NCCCNC(=O)c2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23N3O5/c1-25-15-10-14(11-16(26-2)17(15)27-3)19(24)22-9-5-8-21-18(23)13-6-4-7-20-12-13/h4,6-7,10-12H,5,8-9H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | LUSNOKXMQKZZOD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|