C17H19N3O5 — CID 46651699
N'-[2-(3,4,5-trimethoxyphenyl)acetyl]pyridine-3-carbohydrazide (PubChem CID 46651699) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is N'-[2-(3,4,5-trimethoxyphenyl)acetyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-(3,4,5-trimethoxyphenyl)acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 46651699 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N'-[2-(3,4,5-trimethoxyphenyl)acetyl]pyridine-3-carbohydrazide |
| SMILES | COc1cc(CC(=O)NNC(=O)c2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19N3O5/c1-23-13-7-11(8-14(24-2)16(13)25-3)9-15(21)19-20-17(22)12-5-4-6-18-10-12/h4-8,10H,9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | PMEVYNQUMGRJRC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|