C17H19NO4 — CID 94921716
1-pyridin-3-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one (PubChem CID 94921716) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-pyridin-3-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one.
| Compound Name | 1-pyridin-3-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 94921716 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 1-pyridin-3-yl-3-(3,4,5-trimethoxyphenyl)propan-1-one |
| SMILES | COc1cc(CCC(=O)c2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H19NO4/c1-20-15-9-12(10-16(21-2)17(15)22-3)6-7-14(19)13-5-4-8-18-11-13/h4-5,8-11H,6-7H2,1-3H3 |
| InChIKey | QNRJCWQZSMZNOX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |