C22H21N5O4 — CID 55634332
N-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenyl]pyridine-3-carboxamide (PubChem CID 55634332) has the molecular formula C22H21N5O4 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55634332 |
| Molecular Formula | C22H21N5O4 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenyl]pyridine-3-carboxamide |
| SMILES | COc1ccccc1NCC(=O)NNC(=O)c1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C22H21N5O4/c1-31-19-10-3-2-9-18(19)24-14-20(28)26-27-22(30)15-6-4-8-17(12-15)25-21(29)16-7-5-11-23-13-16/h2-13,24H,14H2,1H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | WBSMIXRPZPPNRL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 121.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|