C20H24N4O5 — CID 55791205
2-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 55791205) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 55791205 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[3-[[[2-(2-methoxyanilino)acetyl]amino]carbamoyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | COc1ccccc1NCC(=O)NNC(=O)c1cccc(OCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C20H24N4O5/c1-24(2)19(26)13-29-15-8-6-7-14(11-15)20(27)23-22-18(25)12-21-16-9-4-5-10-17(16)28-3/h4-11,21H,12-13H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | UQFYEBGQIVTDLD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|