C22H23N3O4S — CID 55831825
3-ethoxy-N'-[2-(2-methoxyanilino)acetyl]-5-phenylthiophene-2-carbohydrazide (PubChem CID 55831825) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-ethoxy-N'-[2-(2-methoxyanilino)acetyl]-5-phenylthiophene-2-carbohydrazide.
| Compound Name | 3-ethoxy-N'-[2-(2-methoxyanilino)acetyl]-5-phenylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55831825 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 3-ethoxy-N'-[2-(2-methoxyanilino)acetyl]-5-phenylthiophene-2-carbohydrazide |
| SMILES | CCOc1cc(-c2ccccc2)sc1C(=O)NNC(=O)CNc1ccccc1OC |
| InChI | InChI=1S/C22H23N3O4S/c1-3-29-18-13-19(15-9-5-4-6-10-15)30-21(18)22(27)25-24-20(26)14-23-16-11-7-8-12-17(16)28-2/h4-13,23H,3,14H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | SYVREHCSBNIAJY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|