C22H22N2O3S — CID 55796192
3-ethoxy-N-[2-methyl-4-(methylcarbamoyl)phenyl]-5-phenylthiophene-2-carboxamide (PubChem CID 55796192) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is 3-ethoxy-N-[2-methyl-4-(methylcarbamoyl)phenyl]-5-phenylthiophene-2-carboxamide.
| Compound Name | 3-ethoxy-N-[2-methyl-4-(methylcarbamoyl)phenyl]-5-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55796192 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 3-ethoxy-N-[2-methyl-4-(methylcarbamoyl)phenyl]-5-phenylthiophene-2-carboxamide |
| SMILES | CCOc1cc(-c2ccccc2)sc1C(=O)Nc1ccc(C(=O)NC)cc1C |
| InChI | InChI=1S/C22H22N2O3S/c1-4-27-18-13-19(15-8-6-5-7-9-15)28-20(18)22(26)24-17-11-10-16(12-14(17)2)21(25)23-3/h5-13H,4H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | HPKYYVVWMWPBIH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |