C17H16F2N2O5 — CID 7719984
3-(difluoromethoxy)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide (PubChem CID 7719984) has the molecular formula C17H16F2N2O5 and a molecular weight of 366.32 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 3-(difluoromethoxy)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7719984 |
| Molecular Formula | C17H16F2N2O5 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 3-(difluoromethoxy)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide |
| SMILES | COc1ccccc1OCC(=O)NNC(=O)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C17H16F2N2O5/c1-24-13-7-2-3-8-14(13)25-10-15(22)20-21-16(23)11-5-4-6-12(9-11)26-17(18)19/h2-9,17H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | OIHOQKZNGKLJKQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|