C19H20F2N2O4 — CID 2379796
N'-[(E)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]-2-(2-methoxyphenoxy)acetohydrazide (PubChem CID 2379796) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is N'-[(E)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]-2-(2-methoxyphenoxy)acetohydrazide.
| Compound Name | N'-[(E)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]-2-(2-methoxyphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 2379796 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N'-[(E)-1-[4-(difluoromethoxy)phenyl]prop-1-enyl]-2-(2-methoxyphenoxy)acetohydrazide |
| SMILES | C/C=C(/NNC(=O)COc1ccccc1OC)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H20F2N2O4/c1-3-15(13-8-10-14(11-9-13)27-19(20)21)22-23-18(24)12-26-17-7-5-4-6-16(17)25-2/h3-11,19,22H,12H2,1-2H3,(H,23,24)/b15-3+ |
| InChIKey | JUKLPNDVTUCYST-CRKCGEKBSA-N |
| XLogP | 3.36 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|