C17H16F2N2O6S — CID 8696693
4-(difluoromethylsulfonyl)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide (PubChem CID 8696693) has the molecular formula C17H16F2N2O6S and a molecular weight of 414.39 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 4-(difluoromethylsulfonyl)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 8696693 |
| Molecular Formula | C17H16F2N2O6S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N'-[2-(2-methoxyphenoxy)acetyl]benzohydrazide |
| SMILES | COc1ccccc1OCC(=O)NNC(=O)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C17H16F2N2O6S/c1-26-13-4-2-3-5-14(13)27-10-15(22)20-21-16(23)11-6-8-12(9-7-11)28(24,25)17(18)19/h2-9,17H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | GLKMUDJYVRITMI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|