C20H25N3O6S — CID 18159261
4-[[[2-(2-ethoxyphenoxy)acetyl]amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide (PubChem CID 18159261) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is 4-[[[2-(2-ethoxyphenoxy)acetyl]amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[[[2-(2-ethoxyphenoxy)acetyl]amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 18159261 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[[[2-(2-ethoxyphenoxy)acetyl]amino]carbamoyl]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C20H25N3O6S/c1-4-28-17-7-5-6-8-18(17)29-13-19(24)21-22-20(25)15-9-11-16(12-10-15)30(26,27)23-14(2)3/h5-12,14,23H,4,13H2,1-3H3,(H,21,24)(H,22,25) |
| InChIKey | ZZVRMFCBSAKTLE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|