C26H27N3O6S — CID 16547816
4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide (PubChem CID 16547816) has the molecular formula C26H27N3O6S and a molecular weight of 509.58 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 16547816 |
| Molecular Formula | C26H27N3O6S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N'-[2-(2-ethoxyphenoxy)acetyl]benzohydrazide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)c1ccc(S(=O)(=O)N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C26H27N3O6S/c1-2-34-23-9-5-6-10-24(23)35-18-25(30)27-28-26(31)20-11-13-22(14-12-20)36(32,33)29-16-15-19-7-3-4-8-21(19)17-29/h3-14H,2,15-18H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | OEPQKEAPJXPLKE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|