C26H27FN2O5S — CID 16930290
3,4-diethoxy-N-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]benzamide (PubChem CID 16930290) has the molecular formula C26H27FN2O5S and a molecular weight of 498.58 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]benzamide |
|---|---|
| PubChem CID | 16930290 |
| Molecular Formula | C26H27FN2O5S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3,4-diethoxy-N-[2-(4-fluorophenyl)sulfonyl-3,4-dihydro-1H-isoquinolin-7-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2ccc3c(c2)CN(S(=O)(=O)c2ccc(F)cc2)CC3)cc1OCC |
| InChI | InChI=1S/C26H27FN2O5S/c1-3-33-24-12-6-19(16-25(24)34-4-2)26(30)28-22-9-5-18-13-14-29(17-20(18)15-22)35(31,32)23-10-7-21(27)8-11-23/h5-12,15-16H,3-4,13-14,17H2,1-2H3,(H,28,30) |
| InChIKey | DZYXCEYBXXWAOZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |