C25H34N2O6S — CID 16931041
3,4,5-triethoxy-N-(2-propylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide (PubChem CID 16931041) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(2-propylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(2-propylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 16931041 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 3,4,5-triethoxy-N-(2-propylsulfonyl-3,4-dihydro-1H-isoquinolin-7-yl)benzamide |
| SMILES | CCCS(=O)(=O)N1CCc2ccc(NC(=O)c3cc(OCC)c(OCC)c(OCC)c3)cc2C1 |
| InChI | InChI=1S/C25H34N2O6S/c1-5-13-34(29,30)27-12-11-18-9-10-21(14-20(18)17-27)26-25(28)19-15-22(31-6-2)24(33-8-4)23(16-19)32-7-3/h9-10,14-16H,5-8,11-13,17H2,1-4H3,(H,26,28) |
| InChIKey | NYAAQLQNACJJBI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |