C20H25N3O5S — CID 9492699
N-[(2R)-butan-2-yl]-4-[[(4-ethoxybenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 9492699) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-[[(4-ethoxybenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-[[(4-ethoxybenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9492699 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-[[(4-ethoxybenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCOc1ccc(C(=O)NNC(=O)c2ccc(S(=O)(=O)N[C@H](C)CC)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-4-14(3)23-29(26,27)18-12-8-16(9-13-18)20(25)22-21-19(24)15-6-10-17(11-7-15)28-5-2/h6-14,23H,4-5H2,1-3H3,(H,21,24)(H,22,25)/t14-/m1/s1 |
| InChIKey | IBUSUQGTHACOTJ-CQSZACIVSA-N |
| XLogP | 2.24 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|